C15H20N4O3 — CID 44998685
N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(pyridin-4-ylmethyl)oxamide (PubChem CID 44998685) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 44998685 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(pyridin-4-ylmethyl)oxamide |
| SMILES | O=C(NCCCN1CCCC1=O)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C15H20N4O3/c20-13-3-1-9-19(13)10-2-6-17-14(21)15(22)18-11-12-4-7-16-8-5-12/h4-5,7-8H,1-3,6,9-11H2,(H,17,21)(H,18,22) |
| InChIKey | JVTRVWUMVATVPY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|