C15H19N3O3 — CID 7541598
N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-phenyloxamide (PubChem CID 7541598) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-phenyloxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 7541598 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-phenyloxamide |
| SMILES | O=C(NCCCN1CCCC1=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H19N3O3/c19-13-8-4-10-18(13)11-5-9-16-14(20)15(21)17-12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2,(H,16,20)(H,17,21) |
| InChIKey | RMZPYBGVLUGFBY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|