C20H23N5O3S — CID 7673300
N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)oxamide (PubChem CID 7673300) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)oxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)oxamide |
|---|---|
| PubChem CID | 7673300 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-N'-(2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)oxamide |
| SMILES | O=C(NCCCN1CCCC1=O)C(=O)Nc1c2c(nn1-c1ccccc1)CSC2 |
| InChI | InChI=1S/C20H23N5O3S/c26-17-8-4-10-24(17)11-5-9-21-19(27)20(28)22-18-15-12-29-13-16(15)23-25(18)14-6-2-1-3-7-14/h1-3,6-7H,4-5,8-13H2,(H,21,27)(H,22,28) |
| InChIKey | DVLSNONBYLJKJA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|