C22H28N4O2 — CID 46537628
3-cyclopropyl-N-[3-(2-oxoazepan-1-yl)propyl]-1-phenylpyrazole-5-carboxamide (PubChem CID 46537628) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-cyclopropyl-N-[3-(2-oxoazepan-1-yl)propyl]-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-[3-(2-oxoazepan-1-yl)propyl]-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46537628 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-cyclopropyl-N-[3-(2-oxoazepan-1-yl)propyl]-1-phenylpyrazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1=O)c1cc(C2CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H28N4O2/c27-21-10-5-2-6-14-25(21)15-7-13-23-22(28)20-16-19(17-11-12-17)24-26(20)18-8-3-1-4-9-18/h1,3-4,8-9,16-17H,2,5-7,10-15H2,(H,23,28) |
| InChIKey | LCDVZIFFOWEGIO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|