C17H19N3O — CID 9437858
(3-cyclopropyl-1-phenylpyrazol-5-yl)-pyrrolidin-1-ylmethanone (PubChem CID 9437858) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (3-cyclopropyl-1-phenylpyrazol-5-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (3-cyclopropyl-1-phenylpyrazol-5-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 9437858 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (3-cyclopropyl-1-phenylpyrazol-5-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(C2CC2)nn1-c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C17H19N3O/c21-17(19-10-4-5-11-19)16-12-15(13-8-9-13)18-20(16)14-6-2-1-3-7-14/h1-3,6-7,12-13H,4-5,8-11H2 |
| InChIKey | CGDGOEGARKLIHP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |