C13H11FN2O2 — CID 82376267
3-cyclopropyl-1-(4-fluorophenyl)pyrazole-5-carboxylic acid (PubChem CID 82376267) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is 3-cyclopropyl-1-(4-fluorophenyl)pyrazole-5-carboxylic acid.
| Compound Name | 3-cyclopropyl-1-(4-fluorophenyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82376267 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-cyclopropyl-1-(4-fluorophenyl)pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CC2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H11FN2O2/c14-9-3-5-10(6-4-9)16-12(13(17)18)7-11(15-16)8-1-2-8/h3-8H,1-2H2,(H,17,18) |
| InChIKey | WWFHOLROOWGXKT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |