C13H16N2O3 — CID 117060433
2-(2-oxopyrrolidin-1-yl)ethyl N-phenylcarbamate (PubChem CID 117060433) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)ethyl N-phenylcarbamate.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 117060433 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCN1CCCC1=O |
| InChI | InChI=1S/C13H16N2O3/c16-12-7-4-8-15(12)9-10-18-13(17)14-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,14,17) |
| InChIKey | POVNQHUFOMAXKH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |