C24H21F3N4O4 — CID 70871607
2-(2-oxopyrrolidin-1-yl)ethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 70871607) has the molecular formula C24H21F3N4O4 and a molecular weight of 486.45 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)ethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)ethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 70871607 |
| Molecular Formula | C24H21F3N4O4 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)ethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | O=C(Nc1cccc(Cc2nn(-c3cc(F)c(F)c(F)c3)ccc2=O)c1)OCCN1CCCC1=O |
| InChI | InChI=1S/C24H21F3N4O4/c25-18-13-17(14-19(26)23(18)27)31-8-6-21(32)20(29-31)12-15-3-1-4-16(11-15)28-24(34)35-10-9-30-7-2-5-22(30)33/h1,3-4,6,8,11,13-14H,2,5,7,9-10,12H2,(H,28,34) |
| InChIKey | SBCVOYYKIIKJNO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|