C21H19ClFN3O4 — CID 70871668
2-methoxyethyl N-[3-[[1-(3-chloro-5-fluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 70871668) has the molecular formula C21H19ClFN3O4 and a molecular weight of 431.85 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[[1-(3-chloro-5-fluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[[1-(3-chloro-5-fluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 70871668 |
| Molecular Formula | C21H19ClFN3O4 |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-methoxyethyl N-[3-[[1-(3-chloro-5-fluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(Cc2nn(-c3cc(F)cc(Cl)c3)ccc2=O)c1 |
| InChI | InChI=1S/C21H19ClFN3O4/c1-29-7-8-30-21(28)24-17-4-2-3-14(9-17)10-19-20(27)5-6-26(25-19)18-12-15(22)11-16(23)13-18/h2-6,9,11-13H,7-8,10H2,1H3,(H,24,28) |
| InChIKey | IWROKLKBPHGYOV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|