C25H24F3N3O3 — CID 70905805
cyclohexylmethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 70905805) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is cyclohexylmethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | cyclohexylmethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 70905805 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | cyclohexylmethyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | O=C(Nc1cccc(Cc2nn(-c3cc(F)c(F)c(F)c3)ccc2=O)c1)OCC1CCCCC1 |
| InChI | InChI=1S/C25H24F3N3O3/c26-20-13-19(14-21(27)24(20)28)31-10-9-23(32)22(30-31)12-17-7-4-8-18(11-17)29-25(33)34-15-16-5-2-1-3-6-16/h4,7-11,13-14,16H,1-3,5-6,12,15H2,(H,29,33) |
| InChIKey | SVBSCUJLEMXWAS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|