C22H20F3N3O3 — CID 123824251
3-[[3-[(2-propoxyoxiran-2-yl)amino]phenyl]methyl]-1-(3,4,5-trifluorophenyl)pyridazin-4-one (PubChem CID 123824251) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-[[3-[(2-propoxyoxiran-2-yl)amino]phenyl]methyl]-1-(3,4,5-trifluorophenyl)pyridazin-4-one.
| Compound Name | 3-[[3-[(2-propoxyoxiran-2-yl)amino]phenyl]methyl]-1-(3,4,5-trifluorophenyl)pyridazin-4-one |
|---|---|
| PubChem CID | 123824251 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[[3-[(2-propoxyoxiran-2-yl)amino]phenyl]methyl]-1-(3,4,5-trifluorophenyl)pyridazin-4-one |
| SMILES | CCCOC1(Nc2cccc(Cc3nn(-c4cc(F)c(F)c(F)c4)ccc3=O)c2)CO1 |
| InChI | InChI=1S/C22H20F3N3O3/c1-2-8-30-22(13-31-22)26-15-5-3-4-14(9-15)10-19-20(29)6-7-28(27-19)16-11-17(23)21(25)18(24)12-16/h3-7,9,11-12,26H,2,8,10,13H2,1H3 |
| InChIKey | VVCFKLXUMVYHCM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|