C24H29N5O4 — CID 67341025
2-cyclohexyloxyethyl N-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 67341025) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-cyclohexyloxyethyl N-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | 2-cyclohexyloxyethyl N-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67341025 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-cyclohexyloxyethyl N-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | Cn1cc(-n2ccc(=O)c(Cc3cccc(NC(=O)OCCOC4CCCCC4)c3)n2)cn1 |
| InChI | InChI=1S/C24H29N5O4/c1-28-17-20(16-25-28)29-11-10-23(30)22(27-29)15-18-6-5-7-19(14-18)26-24(31)33-13-12-32-21-8-3-2-4-9-21/h5-7,10-11,14,16-17,21H,2-4,8-9,12-13,15H2,1H3,(H,26,31) |
| InChIKey | ASJWLOVBPVROJD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|