C21H24ClN3O3 — CID 6100468
2-(4-benzyl-7-oxo-1,4-diazepan-1-yl)ethyl N-(3-chlorophenyl)carbamate (PubChem CID 6100468) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2-(4-benzyl-7-oxo-1,4-diazepan-1-yl)ethyl N-(3-chlorophenyl)carbamate.
| Compound Name | 2-(4-benzyl-7-oxo-1,4-diazepan-1-yl)ethyl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 6100468 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-(4-benzyl-7-oxo-1,4-diazepan-1-yl)ethyl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OCCN1CCN(Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C21H24ClN3O3/c22-18-7-4-8-19(15-18)23-21(27)28-14-13-25-12-11-24(10-9-20(25)26)16-17-5-2-1-3-6-17/h1-8,15H,9-14,16H2,(H,23,27) |
| InChIKey | QEJWTNYCWDNQTO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |