About 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate
2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate (PubChem CID 2244784) has the molecular formula C15H13Cl2NO3
and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate.
Molecular Properties
| Compound Name | 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate |
| PubChem CID | 2244784 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OCCOc1ccccc1Cl |
| InChI | InChI=1S/C15H13Cl2NO3/c16-11-4-3-5-12(10-11)18-15(19)21-9-8-20-14-7-2-1-6-13(14)17/h1-7,10H,8-9H2,(H,18,19) |
| InChIKey | QSMWUBBXBPCZBS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate?
The IUPAC name of 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate (CID 2244784) is 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate.
What is the SMILES notation for 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate?
The canonical SMILES for 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate is O=C(Nc1cccc(Cl)c1)OCCOc1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate?
The InChIKey is QSMWUBBXBPCZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO3/c16-11-4-3-5-12(10-11)18-15(19)21-9-8-20-14-7-2-1-6-13(14)17/h1-7,10H,8-9H2,(H,18,19).
What are the key properties of 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate?
2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate has a molecular weight of 326.18 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenoxy)ethyl N-(3-chlorophenyl)carbamate is sourced from PubChem (CID 2244784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).