C20H21Cl2N3O6 — CID 27108720
2-[bis[2-[(3-chlorophenyl)carbamoyloxy]ethyl]azaniumyl]acetate (PubChem CID 27108720) has the molecular formula C20H21Cl2N3O6 and a molecular weight of 470.31 g/mol. Its IUPAC name is 2-[bis[2-[(3-chlorophenyl)carbamoyloxy]ethyl]azaniumyl]acetate.
| Compound Name | 2-[bis[2-[(3-chlorophenyl)carbamoyloxy]ethyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 27108720 |
| Molecular Formula | C20H21Cl2N3O6 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-[bis[2-[(3-chlorophenyl)carbamoyloxy]ethyl]azaniumyl]acetate |
| SMILES | O=C([O-])C[NH+](CCOC(=O)Nc1cccc(Cl)c1)CCOC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3O6/c21-14-3-1-5-16(11-14)23-19(28)30-9-7-25(13-18(26)27)8-10-31-20(29)24-17-6-2-4-15(22)12-17/h1-6,11-12H,7-10,13H2,(H,23,28)(H,24,29)(H,26,27) |
| InChIKey | OZTNTAXHVJHQLJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |