About sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride
sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride (PubChem CID 173150654) has the molecular formula C11H10Cl2NNaO2
and a molecular weight of 282.10 g/mol. Its IUPAC name is sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride.
Molecular Properties
| Compound Name | sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride |
| PubChem CID | 173150654 |
| Molecular Formula | C11H10Cl2NNaO2 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride |
| SMILES | O=C(Nc1cccc(Cl)c1)OCC#CCCl.[H-].[Na+] |
| InChI | InChI=1S/C11H9Cl2NO2.Na.H/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10;;/h3-5,8H,6-7H2,(H,14,15);;/q;+1;-1 |
| InChIKey | LYSJBOVISXQSJS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride?
The IUPAC name of sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride (CID 173150654) is sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride.
What is the SMILES notation for sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride?
The canonical SMILES for sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride is O=C(Nc1cccc(Cl)c1)OCC#CCCl.[H-].[Na+].
What is the InChIKey of sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride?
The InChIKey is LYSJBOVISXQSJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2NO2.Na.H/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10;;/h3-5,8H,6-7H2,(H,14,15);;/q;+1;-1.
What are the key properties of sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride?
sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride has a molecular weight of 282.10 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;hydride is sourced from PubChem (CID 173150654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).