C9H6Cl3NO2 — CID 14150192
2,2-dichloroethenyl N-(3-chlorophenyl)carbamate (PubChem CID 14150192) has the molecular formula C9H6Cl3NO2 and a molecular weight of 266.51 g/mol. Its IUPAC name is 2,2-dichloroethenyl N-(3-chlorophenyl)carbamate.
| Compound Name | 2,2-dichloroethenyl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 14150192 |
| Molecular Formula | C9H6Cl3NO2 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | 2,2-dichloroethenyl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OC=C(Cl)Cl |
| InChI | InChI=1S/C9H6Cl3NO2/c10-6-2-1-3-7(4-6)13-9(14)15-5-8(11)12/h1-5H,(H,13,14) |
| InChIKey | VRCOJXOIMBUCIR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|