C14H10ClNO4 — CID 127552969
1,3-benzodioxol-5-yl N-(3-chlorophenyl)carbamate (PubChem CID 127552969) has the molecular formula C14H10ClNO4 and a molecular weight of 291.69 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl N-(3-chlorophenyl)carbamate.
| Compound Name | 1,3-benzodioxol-5-yl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 127552969 |
| Molecular Formula | C14H10ClNO4 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1,3-benzodioxol-5-yl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10ClNO4/c15-9-2-1-3-10(6-9)16-14(17)20-11-4-5-12-13(7-11)19-8-18-12/h1-7H,8H2,(H,16,17) |
| InChIKey | CNLQQXVRXPMSAC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |