C24H21ClN2O5 — CID 46286242
1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-chlorophenyl)urea (PubChem CID 46286242) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is 1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 46286242 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-chlorophenyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)NC(Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21ClN2O5/c25-17-2-1-3-18(12-17)26-24(28)27-19(8-15-4-6-20-22(10-15)31-13-29-20)9-16-5-7-21-23(11-16)32-14-30-21/h1-7,10-12,19H,8-9,13-14H2,(H2,26,27,28) |
| InChIKey | UCFVEPHDQAIQTK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |