C25H24N2O6 — CID 46286241
1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-methoxyphenyl)urea (PubChem CID 46286241) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 46286241 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[1,3-bis(1,3-benzodioxol-5-yl)propan-2-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NC(Cc2ccc3c(c2)OCO3)Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C25H24N2O6/c1-29-20-4-2-3-18(13-20)26-25(28)27-19(9-16-5-7-21-23(11-16)32-14-30-21)10-17-6-8-22-24(12-17)33-15-31-22/h2-8,11-13,19H,9-10,14-15H2,1H3,(H2,26,27,28) |
| InChIKey | KRWVZCYAQHXCBC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |