C23H20F2N2O3 — CID 46286172
1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea (PubChem CID 46286172) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 46286172 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[1,3-bis(4-fluorophenyl)propan-2-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)NC(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20F2N2O3/c24-17-5-1-15(2-6-17)11-20(12-16-3-7-18(25)8-4-16)27-23(28)26-19-9-10-21-22(13-19)30-14-29-21/h1-10,13,20H,11-12,14H2,(H2,26,27,28) |
| InChIKey | IAJYHEWTXOMDES-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |