C20H23FN2O3 — CID 46286195
1-[1-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-3-propylurea (PubChem CID 46286195) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-3-propylurea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-3-propylurea |
|---|---|
| PubChem CID | 46286195 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-3-propylurea |
| SMILES | CCCNC(=O)NC(Cc1ccc(F)cc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H23FN2O3/c1-2-9-22-20(24)23-17(10-14-3-6-16(21)7-4-14)11-15-5-8-18-19(12-15)26-13-25-18/h3-8,12,17H,2,9-11,13H2,1H3,(H2,22,23,24) |
| InChIKey | GARRQQCZFCRJFH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |