C22H28N2O3 — CID 92865396
1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-(3-methylbutyl)urea (PubChem CID 92865396) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-(3-methylbutyl)urea.
| Compound Name | 1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 92865396 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-(3-methylbutyl)urea |
| SMILES | CC(C)CCNC(=O)N[C@H](Cc1ccccc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H28N2O3/c1-16(2)10-11-23-22(25)24-19(12-17-6-4-3-5-7-17)13-18-8-9-20-21(14-18)27-15-26-20/h3-9,14,16,19H,10-13,15H2,1-2H3,(H2,23,24,25)/t19-/m1/s1 |
| InChIKey | YNUNUMFOSDVBGO-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |