C25H31NO6 — CID 127031389
(2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-4-hydroxy-N-(3-methylbutyl)butanamide (PubChem CID 127031389) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-4-hydroxy-N-(3-methylbutyl)butanamide.
| Compound Name | (2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-4-hydroxy-N-(3-methylbutyl)butanamide |
|---|---|
| PubChem CID | 127031389 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-4-hydroxy-N-(3-methylbutyl)butanamide |
| SMILES | CC(C)CCNC(=O)[C@@H](Cc1ccc2c(c1)OCO2)[C@@H](CO)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H31NO6/c1-16(2)7-8-26-25(28)20(10-18-4-6-22-24(12-18)32-15-30-22)19(13-27)9-17-3-5-21-23(11-17)31-14-29-21/h3-6,11-12,16,19-20,27H,7-10,13-15H2,1-2H3,(H,26,28)/t19-,20+/m1/s1 |
| InChIKey | NWPHBTBXPVURAU-UXHICEINSA-N |
| XLogP | 3.32 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |