C22H22O8 — CID 172870223
(2R,3R)-2,3-bis(1,3-benzodioxol-5-ylmethyl)hexanedioic acid (PubChem CID 172870223) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(1,3-benzodioxol-5-ylmethyl)hexanedioic acid.
| Compound Name | (2R,3R)-2,3-bis(1,3-benzodioxol-5-ylmethyl)hexanedioic acid |
|---|---|
| PubChem CID | 172870223 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (2R,3R)-2,3-bis(1,3-benzodioxol-5-ylmethyl)hexanedioic acid |
| SMILES | O=C(O)CC[C@H](Cc1ccc2c(c1)OCO2)[C@@H](Cc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C22H22O8/c23-21(24)6-3-15(7-13-1-4-17-19(9-13)29-11-27-17)16(22(25)26)8-14-2-5-18-20(10-14)30-12-28-18/h1-2,4-5,9-10,15-16H,3,6-8,11-12H2,(H,23,24)(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | LLGPOLYPMAOMKS-HZPDHXFCSA-N |
| XLogP | 3.11 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |