C14H18O4 — CID 79729013
5-(1,3-benzodioxol-5-yl)-2,3-dimethylpentanoic acid (PubChem CID 79729013) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-2,3-dimethylpentanoic acid.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-2,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 79729013 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-2,3-dimethylpentanoic acid |
| SMILES | CC(CCc1ccc2c(c1)OCO2)C(C)C(=O)O |
| InChI | InChI=1S/C14H18O4/c1-9(10(2)14(15)16)3-4-11-5-6-12-13(7-11)18-8-17-12/h5-7,9-10H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | JHCMGYYKRDIOKQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |