C15H22N2O4 — CID 131886135
4-(1,3-benzodioxol-5-yl)butan-2-ylhydrazine;but-2-enoic acid (PubChem CID 131886135) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)butan-2-ylhydrazine;but-2-enoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)butan-2-ylhydrazine;but-2-enoic acid |
|---|---|
| PubChem CID | 131886135 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)butan-2-ylhydrazine;but-2-enoic acid |
| SMILES | CC(CCc1ccc2c(c1)OCO2)NN.CC=CC(=O)O |
| InChI | InChI=1S/C11H16N2O2.C4H6O2/c1-8(13-12)2-3-9-4-5-10-11(6-9)15-7-14-10;1-2-3-4(5)6/h4-6,8,13H,2-3,7,12H2,1H3;2-3H,1H3,(H,5,6) |
| InChIKey | VBHKSHNFKTYKPF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|