C23H28N2O3 — CID 92865398
1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-cyclohexylurea (PubChem CID 92865398) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-cyclohexylurea.
| Compound Name | 1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 92865398 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-[(2R)-1-(1,3-benzodioxol-5-yl)-3-phenylpropan-2-yl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N[C@H](Cc1ccccc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H28N2O3/c26-23(24-19-9-5-2-6-10-19)25-20(13-17-7-3-1-4-8-17)14-18-11-12-21-22(15-18)28-16-27-21/h1,3-4,7-8,11-12,15,19-20H,2,5-6,9-10,13-14,16H2,(H2,24,25,26)/t20-/m1/s1 |
| InChIKey | FSVJUHASXIWDDD-HXUWFJFHSA-N |
| XLogP | 4.20 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |