C12H13Cl4NO2 — CID 819742
[3-chloro-2,2-bis(chloromethyl)propyl] N-(3-chlorophenyl)carbamate (PubChem CID 819742) has the molecular formula C12H13Cl4NO2 and a molecular weight of 345.05 g/mol. Its IUPAC name is [3-chloro-2,2-bis(chloromethyl)propyl] N-(3-chlorophenyl)carbamate.
| Compound Name | [3-chloro-2,2-bis(chloromethyl)propyl] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 819742 |
| Molecular Formula | C12H13Cl4NO2 |
| Molecular Weight | 345.05 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | [3-chloro-2,2-bis(chloromethyl)propyl] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OCC(CCl)(CCl)CCl |
| InChI | InChI=1S/C12H13Cl4NO2/c13-5-12(6-14,7-15)8-19-11(18)17-10-3-1-2-9(16)4-10/h1-4H,5-8H2,(H,17,18) |
| InChIKey | CUVUKUUXFAWVGY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.05 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|