About benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate
benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate (PubChem CID 68619895) has the molecular formula C17H15Cl2NO2
and a molecular weight of 336.22 g/mol. Its IUPAC name is benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate.
Molecular Properties
| Compound Name | benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate |
| PubChem CID | 68619895 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OCC#CCCl.c1ccccc1 |
| InChI | InChI=1S/C11H9Cl2NO2.C6H6/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10;1-2-4-6-5-3-1/h3-5,8H,6-7H2,(H,14,15);1-6H |
| InChIKey | WRJXBIZHULABJA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate?
The IUPAC name of benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate (CID 68619895) is benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate.
What is the SMILES notation for benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate?
The canonical SMILES for benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate is O=C(Nc1cccc(Cl)c1)OCC#CCCl.c1ccccc1.
What is the InChIKey of benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate?
The InChIKey is WRJXBIZHULABJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2NO2.C6H6/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10;1-2-4-6-5-3-1/h3-5,8H,6-7H2,(H,14,15);1-6H.
What are the key properties of benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate?
benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate has a molecular weight of 336.22 g/mol, XLogP of 4.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate is sourced from PubChem (CID 68619895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).