C21H25Cl2NO2 — CID 67576285
4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane (PubChem CID 67576285) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane.
| Compound Name | 4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 67576285 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate;2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1C2CCC(C2)C1(C)C.O=C(Nc1cccc(Cl)c1)OCC#CCCl |
| InChI | InChI=1S/C11H9Cl2NO2.C10H16/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10;1-7-8-4-5-9(6-8)10(7,2)3/h3-5,8H,6-7H2,(H,14,15);8-9H,1,4-6H2,2-3H3 |
| InChIKey | XDGUOTPYNSMPIC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|