C14H18ClNO2 — CID 27108719
cyclohexylmethyl N-(3-chlorophenyl)carbamate (PubChem CID 27108719) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is cyclohexylmethyl N-(3-chlorophenyl)carbamate.
| Compound Name | cyclohexylmethyl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 27108719 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | cyclohexylmethyl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OCC1CCCCC1 |
| InChI | InChI=1S/C14H18ClNO2/c15-12-7-4-8-13(9-12)16-14(17)18-10-11-5-2-1-3-6-11/h4,7-9,11H,1-3,5-6,10H2,(H,16,17) |
| InChIKey | UWIWBIYJEJDCPK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |