C17H22ClNO2 — CID 124922833
[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] N-(3-chlorophenyl)carbamate (PubChem CID 124922833) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is [(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] N-(3-chlorophenyl)carbamate.
| Compound Name | [(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 124922833 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)O[C@@H]1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C17H22ClNO2/c18-14-6-3-7-15(11-14)19-17(20)21-16-9-8-12-4-1-2-5-13(12)10-16/h3,6-7,11-13,16H,1-2,4-5,8-10H2,(H,19,20)/t12-,13-,16+/m0/s1 |
| InChIKey | CZPZXNQLAWYWLP-HEHGZKQESA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |