C17H20ClNO2 — CID 11896848
[(1R,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl] N-(3-chlorophenyl)carbamate (PubChem CID 11896848) has the molecular formula C17H20ClNO2 and a molecular weight of 305.80 g/mol. Its IUPAC name is [(1R,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl] N-(3-chlorophenyl)carbamate.
| Compound Name | [(1R,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 11896848 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [(1R,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)O[C@@H]1C[C@H]2C[C@@H]1[C@H]1CCC[C@H]21 |
| InChI | InChI=1S/C17H20ClNO2/c18-11-3-1-4-12(9-11)19-17(20)21-16-8-10-7-15(16)14-6-2-5-13(10)14/h1,3-4,9-10,13-16H,2,5-8H2,(H,19,20)/t10-,13-,14+,15-,16-/m1/s1 |
| InChIKey | QQVIXMXFASDIPD-LMXXTMHSSA-N |
| XLogP | 4.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |