C17H18ClNO3 — CID 5084152
4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl N-(4-chlorophenyl)carbamate (PubChem CID 5084152) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl N-(4-chlorophenyl)carbamate.
| Compound Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 5084152 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OC1CC2CC1C1CC3OC3C21 |
| InChI | InChI=1S/C17H18ClNO3/c18-9-1-3-10(4-2-9)19-17(20)22-13-6-8-5-11(13)12-7-14-16(21-14)15(8)12/h1-4,8,11-16H,5-7H2,(H,19,20) |
| InChIKey | SHXFBSIHHBENLA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|