C19H23NO4 — CID 124919307
[(1R,2R,3S,5S,7S,8S,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(3-ethoxyphenyl)carbamate (PubChem CID 124919307) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(1R,2R,3S,5S,7S,8S,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(3-ethoxyphenyl)carbamate.
| Compound Name | [(1R,2R,3S,5S,7S,8S,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(3-ethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 124919307 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(1R,2R,3S,5S,7S,8S,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(3-ethoxyphenyl)carbamate |
| SMILES | CCOc1cccc(NC(=O)O[C@@H]2C[C@H]3C[C@H]2[C@@H]2C[C@@H]4O[C@H]4[C@H]32)c1 |
| InChI | InChI=1S/C19H23NO4/c1-2-22-12-5-3-4-11(8-12)20-19(21)24-15-7-10-6-13(15)14-9-16-18(23-16)17(10)14/h3-5,8,10,13-18H,2,6-7,9H2,1H3,(H,20,21)/t10-,13+,14+,15-,16+,17-,18-/m1/s1 |
| InChIKey | TTWBJLXTVXWETO-SJOOKJJESA-N |
| XLogP | 3.45 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|