C16H23ClN2O3 — CID 44724162
1-azoniabicyclo[2.2.2]octan-3-yl N-(3-ethoxyphenyl)carbamate chloride (PubChem CID 44724162) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is 1-azoniabicyclo[2.2.2]octan-3-yl N-(3-ethoxyphenyl)carbamate chloride.
| Compound Name | 1-azoniabicyclo[2.2.2]octan-3-yl N-(3-ethoxyphenyl)carbamate chloride |
|---|---|
| PubChem CID | 44724162 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-azoniabicyclo[2.2.2]octan-3-yl N-(3-ethoxyphenyl)carbamate chloride |
| SMILES | CCOc1cccc(NC(=O)OC2C[NH+]3CCC2CC3)c1.[Cl-] |
| InChI | InChI=1S/C16H22N2O3.ClH/c1-2-20-14-5-3-4-13(10-14)17-16(19)21-15-11-18-8-6-12(15)7-9-18;/h3-5,10,12,15H,2,6-9,11H2,1H3,(H,17,19);1H |
| InChIKey | JJDCNFGSWFVHEM-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |