About (3-methylphenyl) N-(3-ethoxyphenyl)carbamate
(3-methylphenyl) N-(3-ethoxyphenyl)carbamate (PubChem CID 56690131) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is (3-methylphenyl) N-(3-ethoxyphenyl)carbamate.
Molecular Properties
| Compound Name | (3-methylphenyl) N-(3-ethoxyphenyl)carbamate |
| PubChem CID | 56690131 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3-methylphenyl) N-(3-ethoxyphenyl)carbamate |
| SMILES | CCOc1cccc(NC(=O)Oc2cccc(C)c2)c1 |
| InChI | InChI=1S/C16H17NO3/c1-3-19-14-8-5-7-13(11-14)17-16(18)20-15-9-4-6-12(2)10-15/h4-11H,3H2,1-2H3,(H,17,18) |
| InChIKey | JPSUREMEWDUDCY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylphenyl) N-(3-ethoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) N-(3-ethoxyphenyl)carbamate?
The IUPAC name of (3-methylphenyl) N-(3-ethoxyphenyl)carbamate (CID 56690131) is (3-methylphenyl) N-(3-ethoxyphenyl)carbamate.
What is the SMILES notation for (3-methylphenyl) N-(3-ethoxyphenyl)carbamate?
The canonical SMILES for (3-methylphenyl) N-(3-ethoxyphenyl)carbamate is CCOc1cccc(NC(=O)Oc2cccc(C)c2)c1.
What is the InChIKey of (3-methylphenyl) N-(3-ethoxyphenyl)carbamate?
The InChIKey is JPSUREMEWDUDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-3-19-14-8-5-7-13(11-14)17-16(18)20-15-9-4-6-12(2)10-15/h4-11H,3H2,1-2H3,(H,17,18).
What are the key properties of (3-methylphenyl) N-(3-ethoxyphenyl)carbamate?
(3-methylphenyl) N-(3-ethoxyphenyl)carbamate has a molecular weight of 271.32 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) N-(3-ethoxyphenyl)carbamate is sourced from PubChem (CID 56690131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).