About ethane;1-ethoxy-3-methylbenzene;methanol
ethane;1-ethoxy-3-methylbenzene;methanol (PubChem CID 142994688) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;1-ethoxy-3-methylbenzene;methanol.
Molecular Properties
| Compound Name | ethane;1-ethoxy-3-methylbenzene;methanol |
| PubChem CID | 142994688 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;1-ethoxy-3-methylbenzene;methanol |
| SMILES | CC.CCOc1cccc(C)c1.CO |
| InChI | InChI=1S/C9H12O.C2H6.CH4O/c1-3-10-9-6-4-5-8(2)7-9;2*1-2/h4-7H,3H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | IDMOCSIZNDLRMO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethoxy-3-methylbenzene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethoxy-3-methylbenzene;methanol?
The IUPAC name of ethane;1-ethoxy-3-methylbenzene;methanol (CID 142994688) is ethane;1-ethoxy-3-methylbenzene;methanol.
What is the SMILES notation for ethane;1-ethoxy-3-methylbenzene;methanol?
The canonical SMILES for ethane;1-ethoxy-3-methylbenzene;methanol is CC.CCOc1cccc(C)c1.CO.
What is the InChIKey of ethane;1-ethoxy-3-methylbenzene;methanol?
The InChIKey is IDMOCSIZNDLRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C2H6.CH4O/c1-3-10-9-6-4-5-8(2)7-9;2*1-2/h4-7H,3H2,1-2H3;1-2H3;2H,1H3.
What are the key properties of ethane;1-ethoxy-3-methylbenzene;methanol?
ethane;1-ethoxy-3-methylbenzene;methanol has a molecular weight of 198.31 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethoxy-3-methylbenzene;methanol is sourced from PubChem (CID 142994688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).