C18H27ClN2O3 — CID 44722400
1-azoniabicyclo[2.2.2]octan-3-yl N-(3-butoxyphenyl)carbamate chloride (PubChem CID 44722400) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-azoniabicyclo[2.2.2]octan-3-yl N-(3-butoxyphenyl)carbamate chloride.
| Compound Name | 1-azoniabicyclo[2.2.2]octan-3-yl N-(3-butoxyphenyl)carbamate chloride |
|---|---|
| PubChem CID | 44722400 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-azoniabicyclo[2.2.2]octan-3-yl N-(3-butoxyphenyl)carbamate chloride |
| SMILES | CCCCOc1cccc(NC(=O)OC2C[NH+]3CCC2CC3)c1.[Cl-] |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-2-3-11-22-16-6-4-5-15(12-16)19-18(21)23-17-13-20-9-7-14(17)8-10-20;/h4-6,12,14,17H,2-3,7-11,13H2,1H3,(H,19,21);1H |
| InChIKey | VEQOZTJAOVEJDO-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|