C24H38N2O3 — CID 11741858
[(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclohexyl] N-(3-hexoxyphenyl)carbamate (PubChem CID 11741858) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclohexyl] N-(3-hexoxyphenyl)carbamate.
| Compound Name | [(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclohexyl] N-(3-hexoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11741858 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | [(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclohexyl] N-(3-hexoxyphenyl)carbamate |
| SMILES | CCCCCCOc1cccc(NC(=O)O[C@@H]2CCCC[C@H]2CN2CCCC2)c1 |
| InChI | InChI=1S/C24H38N2O3/c1-2-3-4-9-17-28-22-13-10-12-21(18-22)25-24(27)29-23-14-6-5-11-20(23)19-26-15-7-8-16-26/h10,12-13,18,20,23H,2-9,11,14-17,19H2,1H3,(H,25,27)/t20-,23+/m0/s1 |
| InChIKey | FONPGMMIBDOPSH-NZQKXSOJSA-N |
| XLogP | 5.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|