C24H39N3O3 — CID 3087334
1,3-di(piperidin-1-yl)propan-2-yl N-(3-butoxyphenyl)carbamate (PubChem CID 3087334) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 1,3-di(piperidin-1-yl)propan-2-yl N-(3-butoxyphenyl)carbamate.
| Compound Name | 1,3-di(piperidin-1-yl)propan-2-yl N-(3-butoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3087334 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 1,3-di(piperidin-1-yl)propan-2-yl N-(3-butoxyphenyl)carbamate |
| SMILES | CCCCOc1cccc(NC(=O)OC(CN2CCCCC2)CN2CCCCC2)c1 |
| InChI | InChI=1S/C24H39N3O3/c1-2-3-17-29-22-12-10-11-21(18-22)25-24(28)30-23(19-26-13-6-4-7-14-26)20-27-15-8-5-9-16-27/h10-12,18,23H,2-9,13-17,19-20H2,1H3,(H,25,28) |
| InChIKey | GMGXZNDWCDKLQE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|