C19H30N2O4 — CID 24836354
(1-hydroxy-3-piperidin-1-ylpropan-2-yl) N-(3-butoxyphenyl)carbamate (PubChem CID 24836354) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1-hydroxy-3-piperidin-1-ylpropan-2-yl) N-(3-butoxyphenyl)carbamate.
| Compound Name | (1-hydroxy-3-piperidin-1-ylpropan-2-yl) N-(3-butoxyphenyl)carbamate |
|---|---|
| PubChem CID | 24836354 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (1-hydroxy-3-piperidin-1-ylpropan-2-yl) N-(3-butoxyphenyl)carbamate |
| SMILES | CCCCOc1cccc(NC(=O)OC(CO)CN2CCCCC2)c1 |
| InChI | InChI=1S/C19H30N2O4/c1-2-3-12-24-17-9-7-8-16(13-17)20-19(23)25-18(15-22)14-21-10-5-4-6-11-21/h7-9,13,18,22H,2-6,10-12,14-15H2,1H3,(H,20,23) |
| InChIKey | WAMCNCDCSRGSCB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|