C21H35N3O4 — CID 101339704
[(2R)-1-methoxy-3-(4-methylpiperazin-1-yl)propan-2-yl] N-(3-pentoxyphenyl)carbamate (PubChem CID 101339704) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is [(2R)-1-methoxy-3-(4-methylpiperazin-1-yl)propan-2-yl] N-(3-pentoxyphenyl)carbamate.
| Compound Name | [(2R)-1-methoxy-3-(4-methylpiperazin-1-yl)propan-2-yl] N-(3-pentoxyphenyl)carbamate |
|---|---|
| PubChem CID | 101339704 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | [(2R)-1-methoxy-3-(4-methylpiperazin-1-yl)propan-2-yl] N-(3-pentoxyphenyl)carbamate |
| SMILES | CCCCCOc1cccc(NC(=O)O[C@@H](COC)CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C21H35N3O4/c1-4-5-6-14-27-19-9-7-8-18(15-19)22-21(25)28-20(17-26-3)16-24-12-10-23(2)11-13-24/h7-9,15,20H,4-6,10-14,16-17H2,1-3H3,(H,22,25)/t20-/m1/s1 |
| InChIKey | HGAXWYGWAWFQND-HXUWFJFHSA-N |
| XLogP | 3.07 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|