C30H43N3O3 — CID 170861981
4-decoxy-N-[3-[2-(4-methylpiperazin-1-yl)acetyl]phenyl]benzamide (PubChem CID 170861981) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is 4-decoxy-N-[3-[2-(4-methylpiperazin-1-yl)acetyl]phenyl]benzamide.
| Compound Name | 4-decoxy-N-[3-[2-(4-methylpiperazin-1-yl)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 170861981 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | 4-decoxy-N-[3-[2-(4-methylpiperazin-1-yl)acetyl]phenyl]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2cccc(C(=O)CN3CCN(C)CC3)c2)cc1 |
| InChI | InChI=1S/C30H43N3O3/c1-3-4-5-6-7-8-9-10-22-36-28-16-14-25(15-17-28)30(35)31-27-13-11-12-26(23-27)29(34)24-33-20-18-32(2)19-21-33/h11-17,23H,3-10,18-22,24H2,1-2H3,(H,31,35) |
| InChIKey | NTEQVYJKOCGTHY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|