C24H43Cl2N3O3 — CID 13127177
[1-(diethylamino)-3-piperidin-1-ylpropan-2-yl] N-(3-pentoxyphenyl)carbamate;dihydrochloride (PubChem CID 13127177) has the molecular formula C24H43Cl2N3O3 and a molecular weight of 492.53 g/mol. Its IUPAC name is [1-(diethylamino)-3-piperidin-1-ylpropan-2-yl] N-(3-pentoxyphenyl)carbamate;dihydrochloride.
| Compound Name | [1-(diethylamino)-3-piperidin-1-ylpropan-2-yl] N-(3-pentoxyphenyl)carbamate;dihydrochloride |
|---|---|
| PubChem CID | 13127177 |
| Molecular Formula | C24H43Cl2N3O3 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | [1-(diethylamino)-3-piperidin-1-ylpropan-2-yl] N-(3-pentoxyphenyl)carbamate;dihydrochloride |
| SMILES | CCCCCOc1cccc(NC(=O)OC(CN(CC)CC)CN2CCCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C24H41N3O3.2ClH/c1-4-7-11-17-29-22-14-12-13-21(18-22)25-24(28)30-23(19-26(5-2)6-3)20-27-15-9-8-10-16-27;;/h12-14,18,23H,4-11,15-17,19-20H2,1-3H3,(H,25,28);2*1H |
| InChIKey | TWLREVRQMAWORK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|