C28H45N3O11 — CID 24836237
[1-(diethylamino)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-hexoxyphenyl)carbamate;oxalic acid (PubChem CID 24836237) has the molecular formula C28H45N3O11 and a molecular weight of 599.68 g/mol. Its IUPAC name is [1-(diethylamino)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-hexoxyphenyl)carbamate;oxalic acid.
| Compound Name | [1-(diethylamino)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-hexoxyphenyl)carbamate;oxalic acid |
|---|---|
| PubChem CID | 24836237 |
| Molecular Formula | C28H45N3O11 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | [1-(diethylamino)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-hexoxyphenyl)carbamate;oxalic acid |
| SMILES | CCCCCCOc1ccccc1NC(=O)OC(CN(CC)CC)CN1CCCC1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H41N3O3.2C2H2O4/c1-4-7-8-13-18-29-23-15-10-9-14-22(23)25-24(28)30-21(19-26(5-2)6-3)20-27-16-11-12-17-27;2*3-1(4)2(5)6/h9-10,14-15,21H,4-8,11-13,16-20H2,1-3H3,(H,25,28);2*(H,3,4)(H,5,6) |
| InChIKey | NVGGPSNNMFLNDE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 203.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|