C25H42N2O3 — CID 102023040
[(2R)-1-piperidin-1-ylpropan-2-yl] N-(2-decoxyphenyl)carbamate (PubChem CID 102023040) has the molecular formula C25H42N2O3 and a molecular weight of 418.62 g/mol. Its IUPAC name is [(2R)-1-piperidin-1-ylpropan-2-yl] N-(2-decoxyphenyl)carbamate.
| Compound Name | [(2R)-1-piperidin-1-ylpropan-2-yl] N-(2-decoxyphenyl)carbamate |
|---|---|
| PubChem CID | 102023040 |
| Molecular Formula | C25H42N2O3 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | [(2R)-1-piperidin-1-ylpropan-2-yl] N-(2-decoxyphenyl)carbamate |
| SMILES | CCCCCCCCCCOc1ccccc1NC(=O)O[C@H](C)CN1CCCCC1 |
| InChI | InChI=1S/C25H42N2O3/c1-3-4-5-6-7-8-9-15-20-29-24-17-12-11-16-23(24)26-25(28)30-22(2)21-27-18-13-10-14-19-27/h11-12,16-17,22H,3-10,13-15,18-21H2,1-2H3,(H,26,28)/t22-/m1/s1 |
| InChIKey | SRFXFGBUZJIGHN-JOCHJYFZSA-N |
| XLogP | 6.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|