C22H36N2O4 — CID 101026136
(2-ethoxy-1-pyrrolidin-1-ylethyl) N-(2-heptoxyphenyl)carbamate (PubChem CID 101026136) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2-ethoxy-1-pyrrolidin-1-ylethyl) N-(2-heptoxyphenyl)carbamate.
| Compound Name | (2-ethoxy-1-pyrrolidin-1-ylethyl) N-(2-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 101026136 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (2-ethoxy-1-pyrrolidin-1-ylethyl) N-(2-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OC(COCC)N1CCCC1 |
| InChI | InChI=1S/C22H36N2O4/c1-3-5-6-7-12-17-27-20-14-9-8-13-19(20)23-22(25)28-21(18-26-4-2)24-15-10-11-16-24/h8-9,13-14,21H,3-7,10-12,15-18H2,1-2H3,(H,23,25) |
| InChIKey | YRLZUGSRVKEJTA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|