C21H35ClN2O3 — CID 10250309
1-piperidin-1-ylpropan-2-yl N-(2-hexoxyphenyl)carbamate;hydrochloride (PubChem CID 10250309) has the molecular formula C21H35ClN2O3 and a molecular weight of 398.98 g/mol. Its IUPAC name is 1-piperidin-1-ylpropan-2-yl N-(2-hexoxyphenyl)carbamate;hydrochloride.
| Compound Name | 1-piperidin-1-ylpropan-2-yl N-(2-hexoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 10250309 |
| Molecular Formula | C21H35ClN2O3 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 1-piperidin-1-ylpropan-2-yl N-(2-hexoxyphenyl)carbamate;hydrochloride |
| SMILES | CCCCCCOc1ccccc1NC(=O)OC(C)CN1CCCCC1.Cl |
| InChI | InChI=1S/C21H34N2O3.ClH/c1-3-4-5-11-16-25-20-13-8-7-12-19(20)22-21(24)26-18(2)17-23-14-9-6-10-15-23;/h7-8,12-13,18H,3-6,9-11,14-17H2,1-2H3,(H,22,24);1H |
| InChIKey | IRLMPXCYQNAWHJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|